C23H25N3O5 — CID 172651877
7-hydroxy-4-oxo-N-[4-[2-(pentanoylamino)ethylamino]phenyl]chromene-2-carboxamide (PubChem CID 172651877) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 7-hydroxy-4-oxo-N-[4-[2-(pentanoylamino)ethylamino]phenyl]chromene-2-carboxamide.
| Compound Name | 7-hydroxy-4-oxo-N-[4-[2-(pentanoylamino)ethylamino]phenyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 172651877 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 7-hydroxy-4-oxo-N-[4-[2-(pentanoylamino)ethylamino]phenyl]chromene-2-carboxamide |
| SMILES | CCCCC(=O)NCCNc1ccc(NC(=O)c2cc(=O)c3ccc(O)cc3o2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-2-3-4-22(29)25-12-11-24-15-5-7-16(8-6-15)26-23(30)21-14-19(28)18-10-9-17(27)13-20(18)31-21/h5-10,13-14,24,27H,2-4,11-12H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | JIUJIQVTLBCENH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|