C17H13F2NO2 — CID 172654770
5-(2,3-difluorophenyl)-1-ethylindole-3-carboxylic acid (PubChem CID 172654770) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-1-ethylindole-3-carboxylic acid.
| Compound Name | 5-(2,3-difluorophenyl)-1-ethylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 172654770 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-(2,3-difluorophenyl)-1-ethylindole-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c2cc(-c3cccc(F)c3F)ccc21 |
| InChI | InChI=1S/C17H13F2NO2/c1-2-20-9-13(17(21)22)12-8-10(6-7-15(12)20)11-4-3-5-14(18)16(11)19/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | LOQRABSEQZOIBI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |