C7H12N2O2 — CID 172655153
methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate (PubChem CID 172655153) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate.
| Compound Name | methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 172655153 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate |
| SMILES | COC(=O)[C@H]1NNC2CC1C2 |
| InChI | InChI=1S/C7H12N2O2/c1-11-7(10)6-4-2-5(3-4)8-9-6/h4-6,8-9H,2-3H2,1H3/t4?,5?,6-/m0/s1 |
| InChIKey | RFNAYPCGDTXCOM-WRVKLSGPSA-N |
| XLogP | -0.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |