methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate

C7H12N2O2 — CID 172655153

IUPACmethyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate
SMILESCOC(=O)[C@H]1NNC2CC1C2
InChIInChI=1S/C7H12N2O2/c1-11-7(10)6-4-2-5(3-4)8-9-6/h4-6,8-9H,2-3H2,1H3/t4?,5?,6-/m0/s1
InChIKeyRFNAYPCGDTXCOM-WRVKLSGPSA-N
MW156.19 g/mol
LogP-0.59
Rot. Bonds1

About methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate

methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate (PubChem CID 172655153) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate.

Molecular Properties

Compound Namemethyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate
PubChem CID172655153
Molecular FormulaC7H12N2O2
Molecular Weight156.19 g/mol
Exact Mass156.09
IUPAC Namemethyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate
SMILESCOC(=O)[C@H]1NNC2CC1C2
InChIInChI=1S/C7H12N2O2/c1-11-7(10)6-4-2-5(3-4)8-9-6/h4-6,8-9H,2-3H2,1H3/t4?,5?,6-/m0/s1
InChIKeyRFNAYPCGDTXCOM-WRVKLSGPSA-N
XLogP-0.59
TPSA50.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.19
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate?
The IUPAC name of methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate (CID 172655153) is methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate.
What is the SMILES notation for methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate?
The canonical SMILES for methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate is COC(=O)[C@H]1NNC2CC1C2.
What is the InChIKey of methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate?
The InChIKey is RFNAYPCGDTXCOM-WRVKLSGPSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-11-7(10)6-4-2-5(3-4)8-9-6/h4-6,8-9H,2-3H2,1H3/t4?,5?,6-/m0/s1.
What are the key properties of methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate?
methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate has a molecular weight of 156.19 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate is sourced from PubChem (CID 172655153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).