C22H22FN3O4 — CID 172657453
N-[5-[(4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]-2-methylphenyl]-2-fluorobenzamide (PubChem CID 172657453) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is N-[5-[(4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]-2-methylphenyl]-2-fluorobenzamide.
| Compound Name | N-[5-[(4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]-2-methylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 172657453 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[5-[(4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]-2-methylphenyl]-2-fluorobenzamide |
| SMILES | Cc1ccc(C(=O)N2CC[C@H]3OCC(=O)N[C@H]3C2)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C22H22FN3O4/c1-13-6-7-14(10-17(13)25-21(28)15-4-2-3-5-16(15)23)22(29)26-9-8-19-18(11-26)24-20(27)12-30-19/h2-7,10,18-19H,8-9,11-12H2,1H3,(H,24,27)(H,25,28)/t18-,19+/m0/s1 |
| InChIKey | QUMWCSCLUUQTCI-RBUKOAKNSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |