C23H32N4O2 — CID 172658398
4-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-1-(1-phenylethyl)pyridine-3-carboxamide (PubChem CID 172658398) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-1-(1-phenylethyl)pyridine-3-carboxamide.
| Compound Name | 4-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-1-(1-phenylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172658398 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-1-(1-phenylethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccn(C(C)c2ccccc2)c(=O)c1C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C23H32N4O2/c1-18-10-13-27(19(2)20-8-5-4-6-9-20)23(29)21(18)22(28)24-11-7-12-26-16-14-25(3)15-17-26/h4-6,8-10,13,19H,7,11-12,14-17H2,1-3H3,(H,24,28) |
| InChIKey | LXZUQKXVALLSNU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|