C18H29N5O2 — CID 172658727
N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[2-(1,2,4-triazol-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172658727) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[2-(1,2,4-triazol-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[2-(1,2,4-triazol-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172658727 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[2-(1,2,4-triazol-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(CCn3cncn3)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C18H29N5O2/c1-13(24)21-17-6-15-8-22(4-5-23-12-19-11-20-23)9-16(15)7-18(17)25-10-14-2-3-14/h11-12,14-18H,2-10H2,1H3,(H,21,24)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | CBJCGUGGKZOIJH-XMTFNYHQSA-N |
| XLogP | 0.92 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |