C12H11N3O3S — CID 17265962
1-(1,3-benzodioxol-5-yl)-3-(5-methyl-1,2-oxazol-3-yl)thiourea (PubChem CID 17265962) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-1,2-oxazol-3-yl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-1,2-oxazol-3-yl)thiourea |
|---|---|
| PubChem CID | 17265962 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(5-methyl-1,2-oxazol-3-yl)thiourea |
| SMILES | Cc1cc(NC(=S)Nc2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C12H11N3O3S/c1-7-4-11(15-18-7)14-12(19)13-8-2-3-9-10(5-8)17-6-16-9/h2-5H,6H2,1H3,(H2,13,14,15,19) |
| InChIKey | SDSCOCVJSYVJGT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|