C15H15N3O2S — CID 970340
1-(1,3-benzodioxol-5-yl)-3-(4,6-dimethyl-2-pyridinyl)thiourea (PubChem CID 970340) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4,6-dimethyl-2-pyridinyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4,6-dimethyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 970340 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4,6-dimethyl-2-pyridinyl)thiourea |
| SMILES | Cc1cc(C)nc(NC(=S)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-9-5-10(2)16-14(6-9)18-15(21)17-11-3-4-12-13(7-11)20-8-19-12/h3-7H,8H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | LLJCKRQCKSCWFV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|