C23H28N2O2 — CID 172659668
4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)-1-(3-propan-2-ylphenyl)pyridin-2-one (PubChem CID 172659668) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)-1-(3-propan-2-ylphenyl)pyridin-2-one.
| Compound Name | 4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)-1-(3-propan-2-ylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 172659668 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)-1-(3-propan-2-ylphenyl)pyridin-2-one |
| SMILES | Cc1ccn(-c2cccc(C(C)C)c2)c(=O)c1C(=O)N1CC=CC1C(C)C |
| InChI | InChI=1S/C23H28N2O2/c1-15(2)18-8-6-9-19(14-18)24-13-11-17(5)21(22(24)26)23(27)25-12-7-10-20(25)16(3)4/h6-11,13-16,20H,12H2,1-5H3 |
| InChIKey | CBPUPOHRWXTLTQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|