C21H29N3O5 — CID 172660423
N-[5-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-2-morpholin-4-ylacetamide (PubChem CID 172660423) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[5-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[5-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 172660423 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[5-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-2-morpholin-4-ylacetamide |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3COC[C@@]3(CO)C2)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C21H29N3O5/c1-15-2-3-16(8-18(15)22-19(26)10-23-4-6-28-7-5-23)20(27)24-9-17-11-29-14-21(17,12-24)13-25/h2-3,8,17,25H,4-7,9-14H2,1H3,(H,22,26)/t17-,21-/m0/s1 |
| InChIKey | QTROQYVBRMCFKQ-UWJYYQICSA-N |
| XLogP | 0.35 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |