C22H27N3O5 — CID 172661069
N-[5-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-3-ethyl-1,2-oxazole-5-carboxamide (PubChem CID 172661069) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[5-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-3-ethyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[5-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-3-ethyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 172661069 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[5-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-2-methylphenyl]-3-ethyl-1,2-oxazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2cc(C(=O)N3C[C@H]4COC[C@@]4(COC)C3)ccc2C)on1 |
| InChI | InChI=1S/C22H27N3O5/c1-4-17-8-19(30-24-17)20(26)23-18-7-15(6-5-14(18)2)21(27)25-9-16-10-29-13-22(16,11-25)12-28-3/h5-8,16H,4,9-13H2,1-3H3,(H,23,26)/t16-,22-/m0/s1 |
| InChIKey | VFPVMYVHHYILMJ-AOMKIAJQSA-N |
| XLogP | 2.53 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |