C21H22N4O3S — CID 172661523
N-(1,3-benzothiazol-6-yl)-4-methyl-3-[(2-morpholin-4-ylacetyl)amino]benzamide (PubChem CID 172661523) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-4-methyl-3-[(2-morpholin-4-ylacetyl)amino]benzamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-4-methyl-3-[(2-morpholin-4-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 172661523 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-4-methyl-3-[(2-morpholin-4-ylacetyl)amino]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3ncsc3c2)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C21H22N4O3S/c1-14-2-3-15(10-18(14)24-20(26)12-25-6-8-28-9-7-25)21(27)23-16-4-5-17-19(11-16)29-13-22-17/h2-5,10-11,13H,6-9,12H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | QQAYIHDSXKFMIM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |