C16H15N3O5S2 — CID 112525792
N-(1,3-benzothiazol-6-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 112525792) has the molecular formula C16H15N3O5S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112525792 |
| Molecular Formula | C16H15N3O5S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccc2ncsc2c1)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C16H15N3O5S2/c20-16(18-11-1-2-12-14(9-11)25-10-17-12)13-3-4-15(24-13)26(21,22)19-5-7-23-8-6-19/h1-4,9-10H,5-8H2,(H,18,20) |
| InChIKey | XJKSMWUMTTYJHV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |