C24H34N2O4 — CID 172662584
1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(1,3-benzodioxol-5-yl)propan-1-one (PubChem CID 172662584) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(1,3-benzodioxol-5-yl)propan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(1,3-benzodioxol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 172662584 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(1,3-benzodioxol-5-yl)propan-1-one |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)CCc3ccc4c(c3)OCO4)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C24H34N2O4/c1-25(2)20-10-18-12-26(13-19(18)11-22(20)28-14-17-3-4-17)24(27)8-6-16-5-7-21-23(9-16)30-15-29-21/h5,7,9,17-20,22H,3-4,6,8,10-15H2,1-2H3/t18-,19+,20-,22-/m1/s1 |
| InChIKey | INPJTEYYQJOSMG-XAPVIXHLSA-N |
| XLogP | 2.94 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |