C17H26N4O3S — CID 172663522
N-[(3aS,5R,6R,7aR)-2-[3-(2-amino-1,3-thiazol-4-yl)propanoyl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172663522) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-[3-(2-amino-1,3-thiazol-4-yl)propanoyl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-[3-(2-amino-1,3-thiazol-4-yl)propanoyl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172663522 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-[3-(2-amino-1,3-thiazol-4-yl)propanoyl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CCc3csc(N)n3)C[C@H]2C[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H26N4O3S/c1-10(22)19-14-5-11-7-21(8-12(11)6-15(14)24-2)16(23)4-3-13-9-25-17(18)20-13/h9,11-12,14-15H,3-8H2,1-2H3,(H2,18,20)(H,19,22)/t11-,12+,14-,15-/m1/s1 |
| InChIKey | HLPLNVIRPZLATQ-AYRXBEOTSA-N |
| XLogP | 1.05 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |