C15H22FN5O2 — CID 172663741
N-[(3aS,5R,6R,7aR)-2-(6-amino-5-fluoropyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172663741) has the molecular formula C15H22FN5O2 and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-(6-amino-5-fluoropyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-(6-amino-5-fluoropyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172663741 |
| Molecular Formula | C15H22FN5O2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-(6-amino-5-fluoropyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CO[C@@H]1C[C@H]2CN(c3ncnc(N)c3F)C[C@H]2C[C@H]1NC(C)=O |
| InChI | InChI=1S/C15H22FN5O2/c1-8(22)20-11-3-9-5-21(6-10(9)4-12(11)23-2)15-13(16)14(17)18-7-19-15/h7,9-12H,3-6H2,1-2H3,(H,20,22)(H2,17,18,19)/t9-,10+,11-,12-/m1/s1 |
| InChIKey | CLCOMSCXKUFSFF-WRWGMCAJSA-N |
| XLogP | 0.56 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |