C21H24N4O3S — CID 172670595
N-[(3aR,5S,6S,7aS)-2-(1,3-benzothiazol-2-ylmethyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 172670595) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-2-(1,3-benzothiazol-2-ylmethyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-2-(1,3-benzothiazol-2-ylmethyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 172670595 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-2-(1,3-benzothiazol-2-ylmethyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2C[C@H]3CN(Cc4nc5ccccc5s4)C[C@H]3C[C@@H]2O)on1 |
| InChI | InChI=1S/C21H24N4O3S/c1-12-6-18(28-24-12)21(27)23-16-7-13-9-25(10-14(13)8-17(16)26)11-20-22-15-4-2-3-5-19(15)29-20/h2-6,13-14,16-17,26H,7-11H2,1H3,(H,23,27)/t13-,14+,16-,17-/m0/s1 |
| InChIKey | CNCHJPNOXMSVTL-FSDCSDTHSA-N |
| XLogP | 2.59 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |