C23H29N3O4 — CID 172673810
methyl 4-[[(3aS,5R,6R,7aR)-2-(4-ethyl-5-methylpyrimidin-2-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 172673810) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl 4-[[(3aS,5R,6R,7aR)-2-(4-ethyl-5-methylpyrimidin-2-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 4-[[(3aS,5R,6R,7aR)-2-(4-ethyl-5-methylpyrimidin-2-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 172673810 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | methyl 4-[[(3aS,5R,6R,7aR)-2-(4-ethyl-5-methylpyrimidin-2-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | CCc1nc(N2C[C@H]3C[C@@H](Oc4ccc(C(=O)OC)cc4)[C@H](O)C[C@H]3C2)ncc1C |
| InChI | InChI=1S/C23H29N3O4/c1-4-19-14(2)11-24-23(25-19)26-12-16-9-20(27)21(10-17(16)13-26)30-18-7-5-15(6-8-18)22(28)29-3/h5-8,11,16-17,20-21,27H,4,9-10,12-13H2,1-3H3/t16-,17+,20+,21+/m0/s1 |
| InChIKey | WJYYJCIGPMOOTI-XWDORNJCSA-N |
| XLogP | 2.79 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |