C25H28N2O5 — CID 175645204
methyl 4-[[(3aS,5R,6R,7aR)-2-[(5-cyano-2-methoxyphenyl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 175645204) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 4-[[(3aS,5R,6R,7aR)-2-[(5-cyano-2-methoxyphenyl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 4-[[(3aS,5R,6R,7aR)-2-[(5-cyano-2-methoxyphenyl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 175645204 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl 4-[[(3aS,5R,6R,7aR)-2-[(5-cyano-2-methoxyphenyl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | COC(=O)c1ccc(O[C@@H]2C[C@@H]3CN(Cc4cc(C#N)ccc4OC)C[C@@H]3C[C@H]2O)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-30-23-8-3-16(12-26)9-20(23)15-27-13-18-10-22(28)24(11-19(18)14-27)32-21-6-4-17(5-7-21)25(29)31-2/h3-9,18-19,22,24,28H,10-11,13-15H2,1-2H3/t18-,19+,22+,24+/m0/s1 |
| InChIKey | VSQPXZSQUBKOEX-JDKSZYQJSA-N |
| XLogP | 3.00 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |