C20H27NO5S — CID 172671692
methyl 4-[[(3aS,5R,6R,7aR)-2-(2-ethylsulfanylacetyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 172671692) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 4-[[(3aS,5R,6R,7aR)-2-(2-ethylsulfanylacetyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 4-[[(3aS,5R,6R,7aR)-2-(2-ethylsulfanylacetyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 172671692 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl 4-[[(3aS,5R,6R,7aR)-2-(2-ethylsulfanylacetyl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | CCSCC(=O)N1C[C@H]2C[C@@H](Oc3ccc(C(=O)OC)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H27NO5S/c1-3-27-12-19(23)21-10-14-8-17(22)18(9-15(14)11-21)26-16-6-4-13(5-7-16)20(24)25-2/h4-7,14-15,17-18,22H,3,8-12H2,1-2H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | ASXDAFAFVKEPQG-BURFUSLBSA-N |
| XLogP | 2.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |