C17H18N4O — CID 172675537
(3S)-N-(1-benzylpyrrol-3-yl)-1-cyanopyrrolidine-3-carboxamide (PubChem CID 172675537) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (3S)-N-(1-benzylpyrrol-3-yl)-1-cyanopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(1-benzylpyrrol-3-yl)-1-cyanopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 172675537 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3S)-N-(1-benzylpyrrol-3-yl)-1-cyanopyrrolidine-3-carboxamide |
| SMILES | N#CN1CC[C@H](C(=O)Nc2ccn(Cc3ccccc3)c2)C1 |
| InChI | InChI=1S/C17H18N4O/c18-13-21-8-6-15(11-21)17(22)19-16-7-9-20(12-16)10-14-4-2-1-3-5-14/h1-5,7,9,12,15H,6,8,10-11H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | LFNRANSLCDWMQH-HNNXBMFYSA-N |
| XLogP | 2.28 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|