C24H17F3N3O3S- — CID 172676023
(Z)-N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylbenzenecarboximidate (PubChem CID 172676023) has the molecular formula C24H17F3N3O3S- and a molecular weight of 484.48 g/mol. Its IUPAC name is (Z)-N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylbenzenecarboximidate.
| Compound Name | (Z)-N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylbenzenecarboximidate |
|---|---|
| PubChem CID | 172676023 |
| Molecular Formula | C24H17F3N3O3S- |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (Z)-N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylbenzenecarboximidate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)/N=C(\[O-])c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H18F3N3O3S/c1-16-7-9-17(10-8-16)21-15-22(24(25,26)27)28-30(21)19-11-13-20(14-12-19)34(32,33)29-23(31)18-5-3-2-4-6-18/h2-15H,1H3,(H,29,31)/p-1 |
| InChIKey | PZQZSXWDWNEQFT-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|