C11H20OS — CID 172676182
1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]ethanol (PubChem CID 172676182) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]ethanol.
| Compound Name | 1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]ethanol |
|---|---|
| PubChem CID | 172676182 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]ethanol |
| SMILES | CC(O)[C@@H]1[C@@H](S)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C11H20OS/c1-6(12)10-8-4-7(5-9(10)13)11(8,2)3/h6-10,12-13H,4-5H2,1-3H3/t6?,7-,8+,9+,10+/m1/s1 |
| InChIKey | QTAJIAQXRAKSFN-IYZBLWNWSA-N |
| XLogP | 2.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|