C12H21BCl2 — CID 134978873
dichloro-[(1R,2R,3R,5R)-6,6-dimethyl-2-propan-2-yl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 134978873) has the molecular formula C12H21BCl2 and a molecular weight of 247.02 g/mol. Its IUPAC name is dichloro-[(1R,2R,3R,5R)-6,6-dimethyl-2-propan-2-yl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | dichloro-[(1R,2R,3R,5R)-6,6-dimethyl-2-propan-2-yl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 134978873 |
| Molecular Formula | C12H21BCl2 |
| Molecular Weight | 247.02 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | dichloro-[(1R,2R,3R,5R)-6,6-dimethyl-2-propan-2-yl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CC(C)[C@@H]1[C@H]2C[C@@H](C[C@H]1B(Cl)Cl)C2(C)C |
| InChI | InChI=1S/C12H21BCl2/c1-7(2)11-9-5-8(12(9,3)4)6-10(11)13(14)15/h7-11H,5-6H2,1-4H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | ZSHPCQCWJASMRS-LNFKQOIKSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.02 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|