C41H49F3N2O8 — CID 172676794
N-[2-[2-[2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-phenylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 172676794) has the molecular formula C41H49F3N2O8 and a molecular weight of 754.84 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-phenylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[2-[2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-phenylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172676794 |
| Molecular Formula | C41H49F3N2O8 |
| Molecular Weight | 754.84 g/mol |
| Exact Mass | 754.34 |
| IUPAC Name | N-[2-[2-[2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-phenylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CCCc1ccccc1)NCCOCCOCCOCCNCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C39H48N2O6.C2HF3O2/c42-39(18-10-17-33-11-4-1-5-12-33)41-22-24-44-26-28-45-27-25-43-23-21-40-30-36-19-20-37(46-31-34-13-6-2-7-14-34)38(29-36)47-32-35-15-8-3-9-16-35;3-2(4,5)1(6)7/h1-9,11-16,19-20,29,40H,10,17-18,21-28,30-32H2,(H,41,42);(H,6,7) |
| InChIKey | DIYNJLIGTNFVOW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.84 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|