C26H34N6O2 — CID 172681486
2-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-2-ethoxyphenyl]-8-N-(2,2-dimethylpropyl)-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine (PubChem CID 172681486) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-2-ethoxyphenyl]-8-N-(2,2-dimethylpropyl)-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine.
| Compound Name | 2-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-2-ethoxyphenyl]-8-N-(2,2-dimethylpropyl)-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine |
|---|---|
| PubChem CID | 172681486 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-2-ethoxyphenyl]-8-N-(2,2-dimethylpropyl)-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine |
| SMILES | CCOc1cc(-c2oc(C)nc2C)ccc1C1(N)N=Cc2cc(C)nc(NCC(C)(C)C)c2N1 |
| InChI | InChI=1S/C26H34N6O2/c1-8-33-21-12-18(23-16(3)31-17(4)34-23)9-10-20(21)26(27)29-13-19-11-15(2)30-24(22(19)32-26)28-14-25(5,6)7/h9-13,32H,8,14,27H2,1-7H3,(H,28,30) |
| InChIKey | ALPOFHUIJUXEHZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |