C5H11N5 — CID 172683359
4-methyl-1H-pyrimidine-2,4,5-triamine (PubChem CID 172683359) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is 4-methyl-1H-pyrimidine-2,4,5-triamine.
| Compound Name | 4-methyl-1H-pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 172683359 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 4-methyl-1H-pyrimidine-2,4,5-triamine |
| SMILES | CC1(N)N=C(N)NC=C1N |
| InChI | InChI=1S/C5H11N5/c1-5(8)3(6)2-9-4(7)10-5/h2H,6,8H2,1H3,(H3,7,9,10) |
| InChIKey | ARYALVCPMGUCEQ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |