About diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide
diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide (PubChem CID 172686143) has the molecular formula C12H11N3O2PS2-
and a molecular weight of 324.35 g/mol. Its IUPAC name is diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide.
Molecular Properties
| Compound Name | diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide |
| PubChem CID | 172686143 |
| Molecular Formula | C12H11N3O2PS2- |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide |
| SMILES | S=P(S)(Oc1ccccc1)Oc1ccccc1.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C12H11O2PS2.N3/c16-15(17,13-11-7-3-1-4-8-11)14-12-9-5-2-6-10-12;1-3-2/h1-10H,(H,16,17);/q;-1 |
| InChIKey | BBGJSLILFJUSKJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide?
The IUPAC name of diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide (CID 172686143) is diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide.
What is the SMILES notation for diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide?
The canonical SMILES for diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide is S=P(S)(Oc1ccccc1)Oc1ccccc1.[N-]=[N+]=[N-].
What is the InChIKey of diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide?
The InChIKey is BBGJSLILFJUSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O2PS2.N3/c16-15(17,13-11-7-3-1-4-8-11)14-12-9-5-2-6-10-12;1-3-2/h1-10H,(H,16,17);/q;-1.
What are the key properties of diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide?
diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide has a molecular weight of 324.35 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxy-sulfanyl-sulfanylidene-λ5-phosphane azide is sourced from PubChem (CID 172686143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).