C12H28O3 — CID 172688938
2-methylpropan-1-ol;2,2,4-trimethylpentane-1,1-diol (PubChem CID 172688938) has the molecular formula C12H28O3 and a molecular weight of 220.35 g/mol. Its IUPAC name is 2-methylpropan-1-ol;2,2,4-trimethylpentane-1,1-diol.
| Compound Name | 2-methylpropan-1-ol;2,2,4-trimethylpentane-1,1-diol |
|---|---|
| PubChem CID | 172688938 |
| Molecular Formula | C12H28O3 |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | 2-methylpropan-1-ol;2,2,4-trimethylpentane-1,1-diol |
| SMILES | CC(C)CC(C)(C)C(O)O.CC(C)CO |
| InChI | InChI=1S/C8H18O2.C4H10O/c1-6(2)5-8(3,4)7(9)10;1-4(2)3-5/h6-7,9-10H,5H2,1-4H3;4-5H,3H2,1-2H3 |
| InChIKey | BKHQHFTUYNCQDH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|