C18H22N2O2 — CID 172693263
1-(3-benzyl-1,2-oxazol-5-yl)-N-methylcyclohexane-1-carboxamide (PubChem CID 172693263) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(3-benzyl-1,2-oxazol-5-yl)-N-methylcyclohexane-1-carboxamide.
| Compound Name | 1-(3-benzyl-1,2-oxazol-5-yl)-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 172693263 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(3-benzyl-1,2-oxazol-5-yl)-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(c2cc(Cc3ccccc3)no2)CCCCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-19-17(21)18(10-6-3-7-11-18)16-13-15(20-22-16)12-14-8-4-2-5-9-14/h2,4-5,8-9,13H,3,6-7,10-12H2,1H3,(H,19,21) |
| InChIKey | BYVLAHPHBPMDAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |