C23H21FO3S — CID 172695903
2-[1-[4-(2-fluorophenyl)phenyl]ethylsulfinyl]-3-phenylpropanoic acid (PubChem CID 172695903) has the molecular formula C23H21FO3S and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-[1-[4-(2-fluorophenyl)phenyl]ethylsulfinyl]-3-phenylpropanoic acid.
| Compound Name | 2-[1-[4-(2-fluorophenyl)phenyl]ethylsulfinyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 172695903 |
| Molecular Formula | C23H21FO3S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[1-[4-(2-fluorophenyl)phenyl]ethylsulfinyl]-3-phenylpropanoic acid |
| SMILES | CC(c1ccc(-c2ccccc2F)cc1)S(=O)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H21FO3S/c1-16(28(27)22(23(25)26)15-17-7-3-2-4-8-17)18-11-13-19(14-12-18)20-9-5-6-10-21(20)24/h2-14,16,22H,15H2,1H3,(H,25,26) |
| InChIKey | CHXIBNBWTXQDPU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |