About 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol
2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 67714833) has the molecular formula C23H31FO7
and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| PubChem CID | 67714833 |
| Molecular Formula | C23H31FO7 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2F)cc1.OCCOCCOCCOCCO |
| InChI | InChI=1S/C15H13FO2.C8H18O5/c1-10(15(17)18)11-6-8-12(9-7-11)13-4-2-3-5-14(13)16;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-10H,1H3,(H,17,18);9-10H,1-8H2 |
| InChIKey | DERFGAYLZMPZAR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol?
The IUPAC name of 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (CID 67714833) is 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
What is the SMILES notation for 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol?
The canonical SMILES for 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol is CC(C(=O)O)c1ccc(-c2ccccc2F)cc1.OCCOCCOCCOCCO.
What is the InChIKey of 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol?
The InChIKey is DERFGAYLZMPZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO2.C8H18O5/c1-10(15(17)18)11-6-8-12(9-7-11)13-4-2-3-5-14(13)16;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-10H,1H3,(H,17,18);9-10H,1-8H2.
What are the key properties of 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol?
2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol has a molecular weight of 438.49 g/mol, XLogP of 2.70, 13 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-fluorophenyl)phenyl]propanoic acid;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol is sourced from PubChem (CID 67714833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).