About bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone
bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone (PubChem CID 172702037) has the molecular formula C21H24N6O
and a molecular weight of 376.46 g/mol. Its IUPAC name is bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone.
Molecular Properties
| Compound Name | bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone |
| PubChem CID | 172702037 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone |
| SMILES | O=C(N1CC2(C1)CN(c1cccnc1)C2)N1CC2(C1)CN(c1cccnc1)C2 |
| InChI | InChI=1S/C21H24N6O/c28-19(26-13-20(14-26)9-24(10-20)17-3-1-5-22-7-17)27-15-21(16-27)11-25(12-21)18-4-2-6-23-8-18/h1-8H,9-16H2 |
| InChIKey | DBZCDOMPXCRLEG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone?
The IUPAC name of bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone (CID 172702037) is bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone.
What is the SMILES notation for bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone?
The canonical SMILES for bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone is O=C(N1CC2(C1)CN(c1cccnc1)C2)N1CC2(C1)CN(c1cccnc1)C2.
What is the InChIKey of bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone?
The InChIKey is DBZCDOMPXCRLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N6O/c28-19(26-13-20(14-26)9-24(10-20)17-3-1-5-22-7-17)27-15-21(16-27)11-25(12-21)18-4-2-6-23-8-18/h1-8H,9-16H2.
What are the key properties of bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone?
bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone has a molecular weight of 376.46 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-pyridin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)methanone is sourced from PubChem (CID 172702037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).