C21H22F2N6O — CID 172686931
bis[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]methanone (PubChem CID 172686931) has the molecular formula C21H22F2N6O and a molecular weight of 412.44 g/mol. Its IUPAC name is bis[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]methanone.
| Compound Name | bis[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 172686931 |
| Molecular Formula | C21H22F2N6O |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | bis[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]methanone |
| SMILES | O=C(N1CC2(C1)CN(c1ncccc1F)C2)N1CC2(C1)CN(c1ncccc1F)C2 |
| InChI | InChI=1S/C21H22F2N6O/c22-15-3-1-5-24-17(15)26-7-20(8-26)11-28(12-20)19(30)29-13-21(14-29)9-27(10-21)18-16(23)4-2-6-25-18/h1-6H,7-14H2 |
| InChIKey | BDWHCPCSKPMYGN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |