C9H11FN2OP+ — CID 175693881
1-(3-fluoro-2-pyridinyl)-1,4-azaphosphinan-4-ium 4-oxide (PubChem CID 175693881) has the molecular formula C9H11FN2OP+ and a molecular weight of 213.17 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-1,4-azaphosphinan-4-ium 4-oxide.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-1,4-azaphosphinan-4-ium 4-oxide |
|---|---|
| PubChem CID | 175693881 |
| Molecular Formula | C9H11FN2OP+ |
| Molecular Weight | 213.17 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-1,4-azaphosphinan-4-ium 4-oxide |
| SMILES | O=[P+]1CCN(c2ncccc2F)CC1 |
| InChI | InChI=1S/C9H11FN2OP/c10-8-2-1-3-11-9(8)12-4-6-14(13)7-5-12/h1-3H,4-7H2/q+1 |
| InChIKey | HTIKOEAQXRZULS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|