C4H3F4NO4 — CID 172703281
[hydroxy-(2,2,2-trifluoroacetyl)amino] 2-fluoroacetate (PubChem CID 172703281) has the molecular formula C4H3F4NO4 and a molecular weight of 205.06 g/mol. Its IUPAC name is [hydroxy-(2,2,2-trifluoroacetyl)amino] 2-fluoroacetate.
| Compound Name | [hydroxy-(2,2,2-trifluoroacetyl)amino] 2-fluoroacetate |
|---|---|
| PubChem CID | 172703281 |
| Molecular Formula | C4H3F4NO4 |
| Molecular Weight | 205.06 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | [hydroxy-(2,2,2-trifluoroacetyl)amino] 2-fluoroacetate |
| SMILES | O=C(CF)ON(O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C4H3F4NO4/c5-1-2(10)13-9(12)3(11)4(6,7)8/h12H,1H2 |
| InChIKey | DGCBUBHJSUZWPA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.06 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|