C6H8F3NO3 — CID 162572267
N-hydroxy-N-(2,2,2-trifluoroacetyl)butanamide (PubChem CID 162572267) has the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. Its IUPAC name is N-hydroxy-N-(2,2,2-trifluoroacetyl)butanamide.
| Compound Name | N-hydroxy-N-(2,2,2-trifluoroacetyl)butanamide |
|---|---|
| PubChem CID | 162572267 |
| Molecular Formula | C6H8F3NO3 |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | N-hydroxy-N-(2,2,2-trifluoroacetyl)butanamide |
| SMILES | CCCC(=O)N(O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3/c1-2-3-4(11)10(13)5(12)6(7,8)9/h13H,2-3H2,1H3 |
| InChIKey | ZEJWWTDDJUTJCR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|