C10H14F6 — CID 140514090
4,5-bis(trifluoromethyl)oct-4-ene (PubChem CID 140514090) has the molecular formula C10H14F6 and a molecular weight of 248.21 g/mol. Its IUPAC name is 4,5-bis(trifluoromethyl)oct-4-ene.
| Compound Name | 4,5-bis(trifluoromethyl)oct-4-ene |
|---|---|
| PubChem CID | 140514090 |
| Molecular Formula | C10H14F6 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4,5-bis(trifluoromethyl)oct-4-ene |
| SMILES | CCCC(=C(CCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6/c1-3-5-7(9(11,12)13)8(6-4-2)10(14,15)16/h3-6H2,1-2H3 |
| InChIKey | OGYGWHRFVOFLKG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|