C2H6F3NOSi2 — CID 123861253
2,2,2-trifluoro-N,N-disilylacetamide (PubChem CID 123861253) has the molecular formula C2H6F3NOSi2 and a molecular weight of 173.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N,N-disilylacetamide.
| Compound Name | 2,2,2-trifluoro-N,N-disilylacetamide |
|---|---|
| PubChem CID | 123861253 |
| Molecular Formula | C2H6F3NOSi2 |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 2,2,2-trifluoro-N,N-disilylacetamide |
| SMILES | O=C(N([SiH3])[SiH3])C(F)(F)F |
| InChI | InChI=1S/C2H6F3NOSi2/c3-2(4,5)1(7)6(8)9/h8-9H3 |
| InChIKey | SWCASNXSZUNALX-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|