C22H16F6N4O2 — CID 102518969
N-(4-aminophenyl)-N-[4-(4-amino-N-(2,2,2-trifluoroacetyl)anilino)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 102518969) has the molecular formula C22H16F6N4O2 and a molecular weight of 482.38 g/mol. Its IUPAC name is N-(4-aminophenyl)-N-[4-(4-amino-N-(2,2,2-trifluoroacetyl)anilino)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-aminophenyl)-N-[4-(4-amino-N-(2,2,2-trifluoroacetyl)anilino)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102518969 |
| Molecular Formula | C22H16F6N4O2 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-(4-aminophenyl)-N-[4-(4-amino-N-(2,2,2-trifluoroacetyl)anilino)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc(N(C(=O)C(F)(F)F)c2ccc(N(C(=O)C(F)(F)F)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H16F6N4O2/c23-21(24,25)19(33)31(15-5-1-13(29)2-6-15)17-9-11-18(12-10-17)32(20(34)22(26,27)28)16-7-3-14(30)4-8-16/h1-12H,29-30H2 |
| InChIKey | MIRQFNXFMIMKOM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|