C21H17F3N2O — CID 87783673
N-[[2-(4-aminophenyl)phenyl]methyl]-2,2,2-trifluoro-N-phenylacetamide (PubChem CID 87783673) has the molecular formula C21H17F3N2O and a molecular weight of 370.37 g/mol. Its IUPAC name is N-[[2-(4-aminophenyl)phenyl]methyl]-2,2,2-trifluoro-N-phenylacetamide.
| Compound Name | N-[[2-(4-aminophenyl)phenyl]methyl]-2,2,2-trifluoro-N-phenylacetamide |
|---|---|
| PubChem CID | 87783673 |
| Molecular Formula | C21H17F3N2O |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[[2-(4-aminophenyl)phenyl]methyl]-2,2,2-trifluoro-N-phenylacetamide |
| SMILES | Nc1ccc(-c2ccccc2CN(C(=O)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17F3N2O/c22-21(23,24)20(27)26(18-7-2-1-3-8-18)14-16-6-4-5-9-19(16)15-10-12-17(25)13-11-15/h1-13H,14,25H2 |
| InChIKey | YPKGYXHNXWXYDK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|