C15H13F3N2O3S — CID 87326085
N-[[2-(4-aminophenyl)phenyl]methylsulfonyl]-2,2,2-trifluoroacetamide (PubChem CID 87326085) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is N-[[2-(4-aminophenyl)phenyl]methylsulfonyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[2-(4-aminophenyl)phenyl]methylsulfonyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87326085 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[[2-(4-aminophenyl)phenyl]methylsulfonyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc(-c2ccccc2CS(=O)(=O)NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c16-15(17,18)14(21)20-24(22,23)9-11-3-1-2-4-13(11)10-5-7-12(19)8-6-10/h1-8H,9,19H2,(H,20,21) |
| InChIKey | WNJMWRKSPUHGNE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|