C24H17F3N2O2 — CID 87276567
2,2,2-trifluoro-N-[[2-[4-(4-oxoquinolin-1-yl)phenyl]phenyl]methyl]acetamide (PubChem CID 87276567) has the molecular formula C24H17F3N2O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[2-[4-(4-oxoquinolin-1-yl)phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[2-[4-(4-oxoquinolin-1-yl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 87276567 |
| Molecular Formula | C24H17F3N2O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[[2-[4-(4-oxoquinolin-1-yl)phenyl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccccc1-c1ccc(-n2ccc(=O)c3ccccc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H17F3N2O2/c25-24(26,27)23(31)28-15-17-5-1-2-6-19(17)16-9-11-18(12-10-16)29-14-13-22(30)20-7-3-4-8-21(20)29/h1-14H,15H2,(H,28,31) |
| InChIKey | GUKAXIURQBIITB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |