C8H5F3NO2- — CID 88752204
2,2,2-trifluoro-N-oxido-N-phenylacetamide (PubChem CID 88752204) has the molecular formula C8H5F3NO2- and a molecular weight of 204.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-oxido-N-phenylacetamide.
| Compound Name | 2,2,2-trifluoro-N-oxido-N-phenylacetamide |
|---|---|
| PubChem CID | 88752204 |
| Molecular Formula | C8H5F3NO2- |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2,2,2-trifluoro-N-oxido-N-phenylacetamide |
| SMILES | O=C(N([O-])c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H5F3NO2/c9-8(10,11)7(13)12(14)6-4-2-1-3-5-6/h1-5H/q-1 |
| InChIKey | KRMWIAYWBXBPDW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|