C15H11F4NO2 — CID 174755514
N,3,3,3-tetrafluoro-2-hydroxy-N,2-diphenylpropanamide (PubChem CID 174755514) has the molecular formula C15H11F4NO2 and a molecular weight of 313.25 g/mol. Its IUPAC name is N,3,3,3-tetrafluoro-2-hydroxy-N,2-diphenylpropanamide.
| Compound Name | N,3,3,3-tetrafluoro-2-hydroxy-N,2-diphenylpropanamide |
|---|---|
| PubChem CID | 174755514 |
| Molecular Formula | C15H11F4NO2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N,3,3,3-tetrafluoro-2-hydroxy-N,2-diphenylpropanamide |
| SMILES | O=C(N(F)c1ccccc1)C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F4NO2/c16-15(17,18)14(22,11-7-3-1-4-8-11)13(21)20(19)12-9-5-2-6-10-12/h1-10,22H |
| InChIKey | JUTPKWVVVOLXAL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|