C16H10F6N2O4Pd — CID 88752203
palladium(2+);bis(2,2,2-trifluoro-N-oxido-N-phenylacetamide) (PubChem CID 88752203) has the molecular formula C16H10F6N2O4Pd and a molecular weight of 514.67 g/mol. Its IUPAC name is palladium(2+);bis(2,2,2-trifluoro-N-oxido-N-phenylacetamide).
| Compound Name | palladium(2+);bis(2,2,2-trifluoro-N-oxido-N-phenylacetamide) |
|---|---|
| PubChem CID | 88752203 |
| Molecular Formula | C16H10F6N2O4Pd |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | palladium(2+);bis(2,2,2-trifluoro-N-oxido-N-phenylacetamide) |
| SMILES | O=C(N([O-])c1ccccc1)C(F)(F)F.O=C(N([O-])c1ccccc1)C(F)(F)F.[Pd+2] |
| InChI | InChI=1S/2C8H5F3NO2.Pd/c2*9-8(10,11)7(13)12(14)6-4-2-1-3-5-6;/h2*1-5H;/q2*-1;+2 |
| InChIKey | QJAHYKUKYNVUQQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|