C12H7F6NO2 — CID 135009857
2,2,2-trifluoro-N-phenyl-N-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]acetamide (PubChem CID 135009857) has the molecular formula C12H7F6NO2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-phenyl-N-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-phenyl-N-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]acetamide |
|---|---|
| PubChem CID | 135009857 |
| Molecular Formula | C12H7F6NO2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2,2,2-trifluoro-N-phenyl-N-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]acetamide |
| SMILES | O=C(/C=C/N(C(=O)C(F)(F)F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H7F6NO2/c13-11(14,15)9(20)6-7-19(10(21)12(16,17)18)8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | RLSIZJXUKWTINC-VOTSOKGWSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|