C7H15O8P — CID 172703479
2-[2-(2-phosphonooxyethoxy)ethoxy]propanoic acid (PubChem CID 172703479) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-[2-(2-phosphonooxyethoxy)ethoxy]propanoic acid.
| Compound Name | 2-[2-(2-phosphonooxyethoxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 172703479 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[2-(2-phosphonooxyethoxy)ethoxy]propanoic acid |
| SMILES | CC(OCCOCCOP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C7H15O8P/c1-6(7(8)9)14-4-2-13-3-5-15-16(10,11)12/h6H,2-5H2,1H3,(H,8,9)(H2,10,11,12) |
| InChIKey | DGSGHOVWNAQGOF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|