C29H26O4 — CID 172703664
2-[4-[2-[4-(2-hydroxyethoxy)phenyl]-9H-fluoren-9-yl]phenoxy]ethanol (PubChem CID 172703664) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]-9H-fluoren-9-yl]phenoxy]ethanol.
| Compound Name | 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]-9H-fluoren-9-yl]phenoxy]ethanol |
|---|---|
| PubChem CID | 172703664 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]-9H-fluoren-9-yl]phenoxy]ethanol |
| SMILES | OCCOc1ccc(-c2ccc3c(c2)C(c2ccc(OCCO)cc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C29H26O4/c30-15-17-32-23-10-5-20(6-11-23)22-9-14-26-25-3-1-2-4-27(25)29(28(26)19-22)21-7-12-24(13-8-21)33-18-16-31/h1-14,19,29-31H,15-18H2 |
| InChIKey | DHIYPFBSGYDLMM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |