About 9-phenyl-9H-fluoren-2-ol
9-phenyl-9H-fluoren-2-ol (PubChem CID 69029372) has the molecular formula C19H14O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 9-phenyl-9H-fluoren-2-ol.
Molecular Properties
| Compound Name | 9-phenyl-9H-fluoren-2-ol |
| PubChem CID | 69029372 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 9-phenyl-9H-fluoren-2-ol |
| SMILES | Oc1ccc2c(c1)C(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C19H14O/c20-14-10-11-16-15-8-4-5-9-17(15)19(18(16)12-14)13-6-2-1-3-7-13/h1-12,19-20H |
| InChIKey | IAXBONHPFGWWQK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-phenyl-9H-fluoren-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-9H-fluoren-2-ol?
The IUPAC name of 9-phenyl-9H-fluoren-2-ol (CID 69029372) is 9-phenyl-9H-fluoren-2-ol.
What is the SMILES notation for 9-phenyl-9H-fluoren-2-ol?
The canonical SMILES for 9-phenyl-9H-fluoren-2-ol is Oc1ccc2c(c1)C(c1ccccc1)c1ccccc1-2.
What is the InChIKey of 9-phenyl-9H-fluoren-2-ol?
The InChIKey is IAXBONHPFGWWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O/c20-14-10-11-16-15-8-4-5-9-17(15)19(18(16)12-14)13-6-2-1-3-7-13/h1-12,19-20H.
What are the key properties of 9-phenyl-9H-fluoren-2-ol?
9-phenyl-9H-fluoren-2-ol has a molecular weight of 258.32 g/mol, XLogP of 4.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-9H-fluoren-2-ol is sourced from PubChem (CID 69029372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).